C21H25Cl2NO2 — CID 19989943
3-[4-[bis(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]propan-1-ol (PubChem CID 19989943) has the molecular formula C21H25Cl2NO2 and a molecular weight of 394.34 g/mol. Its IUPAC name is 3-[4-[bis(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]propan-1-ol.
| Compound Name | 3-[4-[bis(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 19989943 |
| Molecular Formula | C21H25Cl2NO2 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 3-[4-[bis(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]propan-1-ol |
| SMILES | OCCCN1CCC(C(O)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H25Cl2NO2/c22-19-6-2-16(3-7-19)21(26,17-4-8-20(23)9-5-17)18-10-13-24(14-11-18)12-1-15-25/h2-9,18,25-26H,1,10-15H2 |
| InChIKey | IRPUOFMCNNJPES-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |