C28H28F2N2O2 — CID 14407100
4-[3-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]propoxy]benzonitrile (PubChem CID 14407100) has the molecular formula C28H28F2N2O2 and a molecular weight of 462.54 g/mol. Its IUPAC name is 4-[3-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]propoxy]benzonitrile.
| Compound Name | 4-[3-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 14407100 |
| Molecular Formula | C28H28F2N2O2 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 4-[3-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]propoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCCN2CCC(C(O)(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H28F2N2O2/c29-25-8-4-22(5-9-25)28(33,23-6-10-26(30)11-7-23)24-14-17-32(18-15-24)16-1-19-34-27-12-2-21(20-31)3-13-27/h2-13,24,33H,1,14-19H2 |
| InChIKey | VHNHDYOULIPPPD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|