C29H29F6NO4 — CID 11837570
[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]-bis[4-(trifluoromethoxy)phenyl]methanol (PubChem CID 11837570) has the molecular formula C29H29F6NO4 and a molecular weight of 569.54 g/mol. Its IUPAC name is [1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]-bis[4-(trifluoromethoxy)phenyl]methanol.
| Compound Name | [1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]-bis[4-(trifluoromethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 11837570 |
| Molecular Formula | C29H29F6NO4 |
| Molecular Weight | 569.54 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | [1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]-bis[4-(trifluoromethoxy)phenyl]methanol |
| SMILES | COc1ccc(CCN2CCC(C(O)(c3ccc(OC(F)(F)F)cc3)c3ccc(OC(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H29F6NO4/c1-38-24-8-2-20(3-9-24)14-17-36-18-15-23(16-19-36)27(37,21-4-10-25(11-5-21)39-28(30,31)32)22-6-12-26(13-7-22)40-29(33,34)35/h2-13,23,37H,14-19H2,1H3 |
| InChIKey | ZWVGOIOVQVYBPM-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.54 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |