C14H22N2OS — CID 123350321
N-[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]thiohydroxylamine (PubChem CID 123350321) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is N-[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]thiohydroxylamine.
| Compound Name | N-[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 123350321 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | N-[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]thiohydroxylamine |
| SMILES | COc1ccc(CCN2CCC(NS)CC2)cc1 |
| InChI | InChI=1S/C14H22N2OS/c1-17-14-4-2-12(3-5-14)6-9-16-10-7-13(15-18)8-11-16/h2-5,13,15,18H,6-11H2,1H3 |
| InChIKey | MUXXYMBFDHPUJX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|