C15H21NO3 — CID 174365627
[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl] formate (PubChem CID 174365627) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is [1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl] formate.
| Compound Name | [1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl] formate |
|---|---|
| PubChem CID | 174365627 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | [1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl] formate |
| SMILES | COc1ccc(CCN2CCC(OC=O)CC2)cc1 |
| InChI | InChI=1S/C15H21NO3/c1-18-14-4-2-13(3-5-14)6-9-16-10-7-15(8-11-16)19-12-17/h2-5,12,15H,6-11H2,1H3 |
| InChIKey | GVARZLHUZGZDLI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|