C27H26F6N2O3 — CID 19363752
[1-[(4-aminophenyl)methyl]piperidin-4-yl]-bis[4-(trifluoromethoxy)phenyl]methanol (PubChem CID 19363752) has the molecular formula C27H26F6N2O3 and a molecular weight of 540.50 g/mol. Its IUPAC name is [1-[(4-aminophenyl)methyl]piperidin-4-yl]-bis[4-(trifluoromethoxy)phenyl]methanol.
| Compound Name | [1-[(4-aminophenyl)methyl]piperidin-4-yl]-bis[4-(trifluoromethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 19363752 |
| Molecular Formula | C27H26F6N2O3 |
| Molecular Weight | 540.50 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | [1-[(4-aminophenyl)methyl]piperidin-4-yl]-bis[4-(trifluoromethoxy)phenyl]methanol |
| SMILES | Nc1ccc(CN2CCC(C(O)(c3ccc(OC(F)(F)F)cc3)c3ccc(OC(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H26F6N2O3/c28-26(29,30)37-23-9-3-19(4-10-23)25(36,20-5-11-24(12-6-20)38-27(31,32)33)21-13-15-35(16-14-21)17-18-1-7-22(34)8-2-18/h1-12,21,36H,13-17,34H2 |
| InChIKey | QWDNKPJBMFIAQH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.50 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|