C27H31NO — CID 14698737
(1-benzylpiperidin-4-yl)-bis(4-methylphenyl)methanol (PubChem CID 14698737) has the molecular formula C27H31NO and a molecular weight of 385.55 g/mol. Its IUPAC name is (1-benzylpiperidin-4-yl)-bis(4-methylphenyl)methanol.
| Compound Name | (1-benzylpiperidin-4-yl)-bis(4-methylphenyl)methanol |
|---|---|
| PubChem CID | 14698737 |
| Molecular Formula | C27H31NO |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | (1-benzylpiperidin-4-yl)-bis(4-methylphenyl)methanol |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)C2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H31NO/c1-21-8-12-24(13-9-21)27(29,25-14-10-22(2)11-15-25)26-16-18-28(19-17-26)20-23-6-4-3-5-7-23/h3-15,26,29H,16-20H2,1-2H3 |
| InChIKey | JREWOCABXQGOLN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |