C25H27NO3S — CID 4784925
[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-diphenylmethanol (PubChem CID 4784925) has the molecular formula C25H27NO3S and a molecular weight of 421.56 g/mol. Its IUPAC name is [1-(4-methylphenyl)sulfonylpiperidin-4-yl]-diphenylmethanol.
| Compound Name | [1-(4-methylphenyl)sulfonylpiperidin-4-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 4784925 |
| Molecular Formula | C25H27NO3S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | [1-(4-methylphenyl)sulfonylpiperidin-4-yl]-diphenylmethanol |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H27NO3S/c1-20-12-14-24(15-13-20)30(28,29)26-18-16-23(17-19-26)25(27,21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-15,23,27H,16-19H2,1H3 |
| InChIKey | ZMUFCPNODSSSIR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |