C17H27NO2SSi — CID 102254531
trimethyl-[1-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]ethenyl]silane (PubChem CID 102254531) has the molecular formula C17H27NO2SSi and a molecular weight of 337.56 g/mol. Its IUPAC name is trimethyl-[1-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]ethenyl]silane.
| Compound Name | trimethyl-[1-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]ethenyl]silane |
|---|---|
| PubChem CID | 102254531 |
| Molecular Formula | C17H27NO2SSi |
| Molecular Weight | 337.56 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | trimethyl-[1-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]ethenyl]silane |
| SMILES | C=C(C1CCN(S(=O)(=O)c2ccc(C)cc2)CC1)[Si](C)(C)C |
| InChI | InChI=1S/C17H27NO2SSi/c1-14-6-8-17(9-7-14)21(19,20)18-12-10-16(11-13-18)15(2)22(3,4)5/h6-9,16H,2,10-13H2,1,3-5H3 |
| InChIKey | QDVGZAXQXDIEIH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|