C17H26ClN3O3S — CID 119401627
[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-piperazin-1-ylmethanone;hydrochloride (PubChem CID 119401627) has the molecular formula C17H26ClN3O3S and a molecular weight of 387.93 g/mol. Its IUPAC name is [1-(4-methylphenyl)sulfonylpiperidin-4-yl]-piperazin-1-ylmethanone;hydrochloride.
| Compound Name | [1-(4-methylphenyl)sulfonylpiperidin-4-yl]-piperazin-1-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119401627 |
| Molecular Formula | C17H26ClN3O3S |
| Molecular Weight | 387.93 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | [1-(4-methylphenyl)sulfonylpiperidin-4-yl]-piperazin-1-ylmethanone;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)N3CCNCC3)CC2)cc1.Cl |
| InChI | InChI=1S/C17H25N3O3S.ClH/c1-14-2-4-16(5-3-14)24(22,23)20-10-6-15(7-11-20)17(21)19-12-8-18-9-13-19;/h2-5,15,18H,6-13H2,1H3;1H |
| InChIKey | JLCIBXJNCAGZKY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.93 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |