C40H54N6O8S4 — CID 172867320
1-(4-methylphenyl)sulfonyl-1,4,7-triazonane;1,4,7-tris-(4-methylphenyl)sulfonyl-1,4,7-triazonane (PubChem CID 172867320) has the molecular formula C40H54N6O8S4 and a molecular weight of 875.17 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-1,4,7-triazonane;1,4,7-tris-(4-methylphenyl)sulfonyl-1,4,7-triazonane.
| Compound Name | 1-(4-methylphenyl)sulfonyl-1,4,7-triazonane;1,4,7-tris-(4-methylphenyl)sulfonyl-1,4,7-triazonane |
|---|---|
| PubChem CID | 172867320 |
| Molecular Formula | C40H54N6O8S4 |
| Molecular Weight | 875.17 g/mol |
| Exact Mass | 874.29 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-1,4,7-triazonane;1,4,7-tris-(4-methylphenyl)sulfonyl-1,4,7-triazonane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc(C)cc3)CCN(S(=O)(=O)c3ccc(C)cc3)CC2)cc1.Cc1ccc(S(=O)(=O)N2CCNCCNCC2)cc1 |
| InChI | InChI=1S/C27H33N3O6S3.C13H21N3O2S/c1-22-4-10-25(11-5-22)37(31,32)28-16-18-29(38(33,34)26-12-6-23(2)7-13-26)20-21-30(19-17-28)39(35,36)27-14-8-24(3)9-15-27;1-12-2-4-13(5-3-12)19(17,18)16-10-8-14-6-7-15-9-11-16/h4-15H,16-21H2,1-3H3;2-5,14-15H,6-11H2,1H3 |
| InChIKey | IXSMMQUEOMHREK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 173.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.17 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |