C24H35N3O5S2 — CID 10839404
4,12-bis-(4-methylphenyl)sulfonyl-1-oxa-4,8,12-triazacyclotetradecane (PubChem CID 10839404) has the molecular formula C24H35N3O5S2 and a molecular weight of 509.69 g/mol. Its IUPAC name is 4,12-bis-(4-methylphenyl)sulfonyl-1-oxa-4,8,12-triazacyclotetradecane.
| Compound Name | 4,12-bis-(4-methylphenyl)sulfonyl-1-oxa-4,8,12-triazacyclotetradecane |
|---|---|
| PubChem CID | 10839404 |
| Molecular Formula | C24H35N3O5S2 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 4,12-bis-(4-methylphenyl)sulfonyl-1-oxa-4,8,12-triazacyclotetradecane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCNCCCN(S(=O)(=O)c3ccc(C)cc3)CCOCC2)cc1 |
| InChI | InChI=1S/C24H35N3O5S2/c1-21-5-9-23(10-6-21)33(28,29)26-15-3-13-25-14-4-16-27(18-20-32-19-17-26)34(30,31)24-11-7-22(2)8-12-24/h5-12,25H,3-4,13-20H2,1-2H3 |
| InChIKey | XRYXSGHKXBTKHY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |