C21H28N2O5S2 — CID 13148160
4,7-bis-(4-methylphenyl)sulfonyl-1,4,7-oxadiazecane (PubChem CID 13148160) has the molecular formula C21H28N2O5S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 4,7-bis-(4-methylphenyl)sulfonyl-1,4,7-oxadiazecane.
| Compound Name | 4,7-bis-(4-methylphenyl)sulfonyl-1,4,7-oxadiazecane |
|---|---|
| PubChem CID | 13148160 |
| Molecular Formula | C21H28N2O5S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 4,7-bis-(4-methylphenyl)sulfonyl-1,4,7-oxadiazecane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCOCCN(S(=O)(=O)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H28N2O5S2/c1-18-4-8-20(9-5-18)29(24,25)22-12-3-16-28-17-15-23(14-13-22)30(26,27)21-10-6-19(2)7-11-21/h4-11H,3,12-17H2,1-2H3 |
| InChIKey | ALCBDBDJMOKKJY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |