C24H26N2O8S2 — CID 46851999
2,7-bis(1,4-oxazepan-4-ylsulfonyl)anthracene-9,10-dione (PubChem CID 46851999) has the molecular formula C24H26N2O8S2 and a molecular weight of 534.61 g/mol. Its IUPAC name is 2,7-bis(1,4-oxazepan-4-ylsulfonyl)anthracene-9,10-dione.
| Compound Name | 2,7-bis(1,4-oxazepan-4-ylsulfonyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 46851999 |
| Molecular Formula | C24H26N2O8S2 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 2,7-bis(1,4-oxazepan-4-ylsulfonyl)anthracene-9,10-dione |
| SMILES | O=C1c2ccc(S(=O)(=O)N3CCCOCC3)cc2C(=O)c2cc(S(=O)(=O)N3CCCOCC3)ccc21 |
| InChI | InChI=1S/C24H26N2O8S2/c27-23-19-5-3-17(35(29,30)25-7-1-11-33-13-9-25)15-21(19)24(28)22-16-18(4-6-20(22)23)36(31,32)26-8-2-12-34-14-10-26/h3-6,15-16H,1-2,7-14H2 |
| InChIKey | SXPVLXSVKRYQGE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|