C19H19N2O4S+ — CID 7074376
2-(4-methylpiperazin-4-ium-1-yl)sulfonylanthracene-9,10-dione (PubChem CID 7074376) has the molecular formula C19H19N2O4S+ and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-(4-methylpiperazin-4-ium-1-yl)sulfonylanthracene-9,10-dione.
| Compound Name | 2-(4-methylpiperazin-4-ium-1-yl)sulfonylanthracene-9,10-dione |
|---|---|
| PubChem CID | 7074376 |
| Molecular Formula | C19H19N2O4S+ |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 2-(4-methylpiperazin-4-ium-1-yl)sulfonylanthracene-9,10-dione |
| SMILES | C[NH+]1CCN(S(=O)(=O)c2ccc3c(c2)C(=O)c2ccccc2C3=O)CC1 |
| InChI | InChI=1S/C19H18N2O4S/c1-20-8-10-21(11-9-20)26(24,25)13-6-7-16-17(12-13)19(23)15-5-3-2-4-14(15)18(16)22/h2-7,12H,8-11H2,1H3/p+1 |
| InChIKey | KTIVOUXYYCRAQR-UHFFFAOYSA-O |
| XLogP | -0.02 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|