C23H31N5O5S2+2 — CID 3340443
N-[2,7-bis[(4-methylpiperazin-4-ium-1-yl)sulfonyl]fluoren-9-ylidene]hydroxylamine (PubChem CID 3340443) has the molecular formula C23H31N5O5S2+2 and a molecular weight of 521.67 g/mol. Its IUPAC name is N-[2,7-bis[(4-methylpiperazin-4-ium-1-yl)sulfonyl]fluoren-9-ylidene]hydroxylamine.
| Compound Name | N-[2,7-bis[(4-methylpiperazin-4-ium-1-yl)sulfonyl]fluoren-9-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 3340443 |
| Molecular Formula | C23H31N5O5S2+2 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | N-[2,7-bis[(4-methylpiperazin-4-ium-1-yl)sulfonyl]fluoren-9-ylidene]hydroxylamine |
| SMILES | C[NH+]1CCN(S(=O)(=O)c2ccc3c(c2)C(=NO)c2cc(S(=O)(=O)N4CC[NH+](C)CC4)ccc2-3)CC1 |
| InChI | InChI=1S/C23H29N5O5S2/c1-25-7-11-27(12-8-25)34(30,31)17-3-5-19-20-6-4-18(16-22(20)23(24-29)21(19)15-17)35(32,33)28-13-9-26(2)10-14-28/h3-6,15-16,29H,7-14H2,1-2H3/p+2 |
| InChIKey | IDKUGTHARHYDKV-UHFFFAOYSA-P |
| XLogP | -2.07 |
| TPSA | 116.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|