C25H31N3O7S2 — CID 1120272
N-[7-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylfluoren-9-ylidene]hydroxylamine (PubChem CID 1120272) has the molecular formula C25H31N3O7S2 and a molecular weight of 549.67 g/mol. Its IUPAC name is N-[7-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylfluoren-9-ylidene]hydroxylamine.
| Compound Name | N-[7-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylfluoren-9-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 1120272 |
| Molecular Formula | C25H31N3O7S2 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | N-[7-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylfluoren-9-ylidene]hydroxylamine |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2ccc3c(c2)/C(=N\O)c2cc(S(=O)(=O)N4C[C@H](C)O[C@@H](C)C4)ccc2-3)C[C@H](C)O1 |
| InChI | InChI=1S/C25H31N3O7S2/c1-15-11-27(12-16(2)34-15)36(30,31)19-5-7-21-22-8-6-20(10-24(22)25(26-29)23(21)9-19)37(32,33)28-13-17(3)35-18(4)14-28/h5-10,15-18,29H,11-14H2,1-4H3/b26-25-/t15-,16-,17-,18+/m0/s1 |
| InChIKey | YRCROUKEBKDVAT-IQBBNZNISA-N |
| XLogP | 2.49 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|