C21H23N3O5S2 — CID 1137411
N-[2,7-bis(pyrrolidin-1-ylsulfonyl)fluoren-9-ylidene]hydroxylamine (PubChem CID 1137411) has the molecular formula C21H23N3O5S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is N-[2,7-bis(pyrrolidin-1-ylsulfonyl)fluoren-9-ylidene]hydroxylamine.
| Compound Name | N-[2,7-bis(pyrrolidin-1-ylsulfonyl)fluoren-9-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 1137411 |
| Molecular Formula | C21H23N3O5S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | N-[2,7-bis(pyrrolidin-1-ylsulfonyl)fluoren-9-ylidene]hydroxylamine |
| SMILES | O=S(=O)(c1ccc2c(c1)C(=NO)c1cc(S(=O)(=O)N3CCCC3)ccc1-2)N1CCCC1 |
| InChI | InChI=1S/C21H23N3O5S2/c25-22-21-19-13-15(30(26,27)23-9-1-2-10-23)5-7-17(19)18-8-6-16(14-20(18)21)31(28,29)24-11-3-4-12-24/h5-8,13-14,25H,1-4,9-12H2 |
| InChIKey | MTCZXZQNRRRNDB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|