C31H33F2N3O6S2 — CID 145284794
2-[4-[(9E)-7-(4,4-dimethylcyclohexyl)sulfonyl-9-hydroxyiminofluoren-2-yl]sulfonylpiperazin-1-yl]-4,5-difluorophenol (PubChem CID 145284794) has the molecular formula C31H33F2N3O6S2 and a molecular weight of 645.75 g/mol. Its IUPAC name is 2-[4-[(9E)-7-(4,4-dimethylcyclohexyl)sulfonyl-9-hydroxyiminofluoren-2-yl]sulfonylpiperazin-1-yl]-4,5-difluorophenol.
| Compound Name | 2-[4-[(9E)-7-(4,4-dimethylcyclohexyl)sulfonyl-9-hydroxyiminofluoren-2-yl]sulfonylpiperazin-1-yl]-4,5-difluorophenol |
|---|---|
| PubChem CID | 145284794 |
| Molecular Formula | C31H33F2N3O6S2 |
| Molecular Weight | 645.75 g/mol |
| Exact Mass | 645.18 |
| IUPAC Name | 2-[4-[(9E)-7-(4,4-dimethylcyclohexyl)sulfonyl-9-hydroxyiminofluoren-2-yl]sulfonylpiperazin-1-yl]-4,5-difluorophenol |
| SMILES | CC1(C)CCC(S(=O)(=O)c2ccc3c(c2)/C(=N\O)c2cc(S(=O)(=O)N4CCN(c5cc(F)c(F)cc5O)CC4)ccc2-3)CC1 |
| InChI | InChI=1S/C31H33F2N3O6S2/c1-31(2)9-7-19(8-10-31)43(39,40)20-3-5-22-23-6-4-21(16-25(23)30(34-38)24(22)15-20)44(41,42)36-13-11-35(12-14-36)28-17-26(32)27(33)18-29(28)37/h3-6,15-19,37-38H,7-14H2,1-2H3/b34-30+ |
| InChIKey | OSARWMDFIUPUDS-VBMGMRCRSA-N |
| XLogP | 5.13 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.75 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|