C33H36FN3O7S2 — CID 145284566
(NE)-N-[2-(4,4-dimethylcyclohexyl)sulfonyl-7-[[4-(4-fluoro-2,5-dimethoxyphenyl)-2,3-dihydropyrazin-1-yl]sulfonyl]fluoren-9-ylidene]hydroxylamine (PubChem CID 145284566) has the molecular formula C33H36FN3O7S2 and a molecular weight of 669.80 g/mol. Its IUPAC name is (NE)-N-[2-(4,4-dimethylcyclohexyl)sulfonyl-7-[[4-(4-fluoro-2,5-dimethoxyphenyl)-2,3-dihydropyrazin-1-yl]sulfonyl]fluoren-9-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[2-(4,4-dimethylcyclohexyl)sulfonyl-7-[[4-(4-fluoro-2,5-dimethoxyphenyl)-2,3-dihydropyrazin-1-yl]sulfonyl]fluoren-9-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 145284566 |
| Molecular Formula | C33H36FN3O7S2 |
| Molecular Weight | 669.80 g/mol |
| Exact Mass | 669.20 |
| IUPAC Name | (NE)-N-[2-(4,4-dimethylcyclohexyl)sulfonyl-7-[[4-(4-fluoro-2,5-dimethoxyphenyl)-2,3-dihydropyrazin-1-yl]sulfonyl]fluoren-9-ylidene]hydroxylamine |
| SMILES | COc1cc(N2C=CN(S(=O)(=O)c3ccc4c(c3)/C(=N/O)c3cc(S(=O)(=O)C5CCC(C)(C)CC5)ccc3-4)CC2)c(OC)cc1F |
| InChI | InChI=1S/C33H36FN3O7S2/c1-33(2)11-9-21(10-12-33)45(39,40)22-5-7-24-25-8-6-23(18-27(25)32(35-38)26(24)17-22)46(41,42)37-15-13-36(14-16-37)29-20-30(43-3)28(34)19-31(29)44-4/h5-8,13,15,17-21,38H,9-12,14,16H2,1-4H3/b35-32+ |
| InChIKey | OWTSGHAWTISODF-LVYIWIAJSA-N |
| XLogP | 5.77 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.80 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|