C31H33ClFN3O3S2 — CID 145284687
(NZ)-N-[2-[4-(2-chloro-4-fluorophenyl)piperazin-1-yl]sulfanyl-7-(4,4-dimethylcyclohexyl)sulfonylfluoren-9-ylidene]hydroxylamine (PubChem CID 145284687) has the molecular formula C31H33ClFN3O3S2 and a molecular weight of 614.21 g/mol. Its IUPAC name is (NZ)-N-[2-[4-(2-chloro-4-fluorophenyl)piperazin-1-yl]sulfanyl-7-(4,4-dimethylcyclohexyl)sulfonylfluoren-9-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[2-[4-(2-chloro-4-fluorophenyl)piperazin-1-yl]sulfanyl-7-(4,4-dimethylcyclohexyl)sulfonylfluoren-9-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 145284687 |
| Molecular Formula | C31H33ClFN3O3S2 |
| Molecular Weight | 614.21 g/mol |
| Exact Mass | 613.16 |
| IUPAC Name | (NZ)-N-[2-[4-(2-chloro-4-fluorophenyl)piperazin-1-yl]sulfanyl-7-(4,4-dimethylcyclohexyl)sulfonylfluoren-9-ylidene]hydroxylamine |
| SMILES | CC1(C)CCC(S(=O)(=O)c2ccc3c(c2)/C(=N\O)c2cc(SN4CCN(c5ccc(F)cc5Cl)CC4)ccc2-3)CC1 |
| InChI | InChI=1S/C31H33ClFN3O3S2/c1-31(2)11-9-22(10-12-31)41(38,39)23-5-7-25-24-6-4-21(18-26(24)30(34-37)27(25)19-23)40-36-15-13-35(14-16-36)29-8-3-20(33)17-28(29)32/h3-8,17-19,22,37H,9-16H2,1-2H3/b34-30- |
| InChIKey | OCZINOBNKHEYFR-BVNFUTIRSA-N |
| XLogP | 7.26 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.21 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|