C32H35F2N3O6S2 — CID 145284809
[3-[4-[(9Z)-7-(4,4-dimethylcyclohexyl)sulfonyl-9-hydroxyiminofluoren-2-yl]sulfonylpiperazin-1-yl]-2,6-difluorophenyl]methanol (PubChem CID 145284809) has the molecular formula C32H35F2N3O6S2 and a molecular weight of 659.78 g/mol. Its IUPAC name is [3-[4-[(9Z)-7-(4,4-dimethylcyclohexyl)sulfonyl-9-hydroxyiminofluoren-2-yl]sulfonylpiperazin-1-yl]-2,6-difluorophenyl]methanol.
| Compound Name | [3-[4-[(9Z)-7-(4,4-dimethylcyclohexyl)sulfonyl-9-hydroxyiminofluoren-2-yl]sulfonylpiperazin-1-yl]-2,6-difluorophenyl]methanol |
|---|---|
| PubChem CID | 145284809 |
| Molecular Formula | C32H35F2N3O6S2 |
| Molecular Weight | 659.78 g/mol |
| Exact Mass | 659.19 |
| IUPAC Name | [3-[4-[(9Z)-7-(4,4-dimethylcyclohexyl)sulfonyl-9-hydroxyiminofluoren-2-yl]sulfonylpiperazin-1-yl]-2,6-difluorophenyl]methanol |
| SMILES | CC1(C)CCC(S(=O)(=O)c2ccc3c(c2)/C(=N/O)c2cc(S(=O)(=O)N4CCN(c5ccc(F)c(CO)c5F)CC4)ccc2-3)CC1 |
| InChI | InChI=1S/C32H35F2N3O6S2/c1-32(2)11-9-20(10-12-32)44(40,41)21-3-5-23-24-6-4-22(18-26(24)31(35-39)25(23)17-21)45(42,43)37-15-13-36(14-16-37)29-8-7-28(33)27(19-38)30(29)34/h3-8,17-18,20,38-39H,9-16,19H2,1-2H3/b35-31- |
| InChIKey | GATSOJAPYINYMZ-LLZINOMRSA-N |
| XLogP | 4.92 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.78 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|