C16H14Cl2F2N2O2S — CID 3816055
1-(3,5-dichlorophenyl)sulfonyl-4-(2,4-difluorophenyl)piperazine (PubChem CID 3816055) has the molecular formula C16H14Cl2F2N2O2S and a molecular weight of 407.27 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)sulfonyl-4-(2,4-difluorophenyl)piperazine.
| Compound Name | 1-(3,5-dichlorophenyl)sulfonyl-4-(2,4-difluorophenyl)piperazine |
|---|---|
| PubChem CID | 3816055 |
| Molecular Formula | C16H14Cl2F2N2O2S |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 1-(3,5-dichlorophenyl)sulfonyl-4-(2,4-difluorophenyl)piperazine |
| SMILES | O=S(=O)(c1cc(Cl)cc(Cl)c1)N1CCN(c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C16H14Cl2F2N2O2S/c17-11-7-12(18)9-14(8-11)25(23,24)22-5-3-21(4-6-22)16-2-1-13(19)10-15(16)20/h1-2,7-10H,3-6H2 |
| InChIKey | AHWMHDIDEILDLS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |