C18H20ClFN2O4S — CID 86959908
1-(3-chloro-4-methoxyphenyl)sulfonyl-4-(4-fluoro-2-methoxyphenyl)piperazine (PubChem CID 86959908) has the molecular formula C18H20ClFN2O4S and a molecular weight of 414.89 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)sulfonyl-4-(4-fluoro-2-methoxyphenyl)piperazine.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)sulfonyl-4-(4-fluoro-2-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 86959908 |
| Molecular Formula | C18H20ClFN2O4S |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)sulfonyl-4-(4-fluoro-2-methoxyphenyl)piperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3ccc(F)cc3OC)CC2)cc1Cl |
| InChI | InChI=1S/C18H20ClFN2O4S/c1-25-17-6-4-14(12-15(17)19)27(23,24)22-9-7-21(8-10-22)16-5-3-13(20)11-18(16)26-2/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | UNDGLJCSIYAUIP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |