C11H14ClNO5S2 — CID 110721471
4-(3-chloro-4-methoxyphenyl)sulfonyl-1,4-thiazinane 1,1-dioxide (PubChem CID 110721471) has the molecular formula C11H14ClNO5S2 and a molecular weight of 339.82 g/mol. Its IUPAC name is 4-(3-chloro-4-methoxyphenyl)sulfonyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(3-chloro-4-methoxyphenyl)sulfonyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 110721471 |
| Molecular Formula | C11H14ClNO5S2 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 4-(3-chloro-4-methoxyphenyl)sulfonyl-1,4-thiazinane 1,1-dioxide |
| SMILES | COc1ccc(S(=O)(=O)N2CCS(=O)(=O)CC2)cc1Cl |
| InChI | InChI=1S/C11H14ClNO5S2/c1-18-11-3-2-9(8-10(11)12)20(16,17)13-4-6-19(14,15)7-5-13/h2-3,8H,4-7H2,1H3 |
| InChIKey | MNLVMLWUUNTLJI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |