C18H18ClF3N2O5S2 — CID 37479505
1-(3-chloro-4-methoxyphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine (PubChem CID 37479505) has the molecular formula C18H18ClF3N2O5S2 and a molecular weight of 498.93 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 37479505 |
| Molecular Formula | C18H18ClF3N2O5S2 |
| Molecular Weight | 498.93 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(S(=O)(=O)c3cccc(C(F)(F)F)c3)CC2)cc1Cl |
| InChI | InChI=1S/C18H18ClF3N2O5S2/c1-29-17-6-5-15(12-16(17)19)31(27,28)24-9-7-23(8-10-24)30(25,26)14-4-2-3-13(11-14)18(20,21)22/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | DGGWBARNKIUKRI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.93 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |