C12H15F3N2O2S — CID 697906
1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine (PubChem CID 697906) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.32 g/mol. Its IUPAC name is 1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine.
| Compound Name | 1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 697906 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C12H15F3N2O2S/c1-16-5-7-17(8-6-16)20(18,19)11-4-2-3-10(9-11)12(13,14)15/h2-4,9H,5-8H2,1H3 |
| InChIKey | VNKMBILJDPZQIP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |