C14H15F3N2O3S — CID 166405977
1-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 166405977) has the molecular formula C14H15F3N2O3S and a molecular weight of 348.35 g/mol. Its IUPAC name is 1-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166405977 |
| Molecular Formula | C14H15F3N2O3S |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 1-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C14H15F3N2O3S/c1-2-13(20)18-6-8-19(9-7-18)23(21,22)12-5-3-4-11(10-12)14(15,16)17/h2-5,10H,1,6-9H2 |
| InChIKey | WOFGNTNYZOEVSJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|