C16H15F3N2O3S2 — CID 2441230
thiophen-2-yl-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone (PubChem CID 2441230) has the molecular formula C16H15F3N2O3S2 and a molecular weight of 404.44 g/mol. Its IUPAC name is thiophen-2-yl-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone.
| Compound Name | thiophen-2-yl-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 2441230 |
| Molecular Formula | C16H15F3N2O3S2 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | thiophen-2-yl-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(c1cccs1)N1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H15F3N2O3S2/c17-16(18,19)12-3-1-4-13(11-12)26(23,24)21-8-6-20(7-9-21)15(22)14-5-2-10-25-14/h1-5,10-11H,6-9H2 |
| InChIKey | HCECZUKOQHMPBU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |