C14H16ClF3N2O2S — CID 78818186
1-(2-chloroprop-2-enyl)-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine (PubChem CID 78818186) has the molecular formula C14H16ClF3N2O2S and a molecular weight of 368.81 g/mol. Its IUPAC name is 1-(2-chloroprop-2-enyl)-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine.
| Compound Name | 1-(2-chloroprop-2-enyl)-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 78818186 |
| Molecular Formula | C14H16ClF3N2O2S |
| Molecular Weight | 368.81 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 1-(2-chloroprop-2-enyl)-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine |
| SMILES | C=C(Cl)CN1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C14H16ClF3N2O2S/c1-11(15)10-19-5-7-20(8-6-19)23(21,22)13-4-2-3-12(9-13)14(16,17)18/h2-4,9H,1,5-8,10H2 |
| InChIKey | GBLYNOQTBLLTIO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.81 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |