C17H23F3N2O4S — CID 8689315
tert-butyl 2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetate (PubChem CID 8689315) has the molecular formula C17H23F3N2O4S and a molecular weight of 408.44 g/mol. Its IUPAC name is tert-butyl 2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetate |
|---|---|
| PubChem CID | 8689315 |
| Molecular Formula | C17H23F3N2O4S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | tert-butyl 2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H23F3N2O4S/c1-16(2,3)26-15(23)12-21-7-9-22(10-8-21)27(24,25)14-6-4-5-13(11-14)17(18,19)20/h4-6,11H,7-10,12H2,1-3H3 |
| InChIKey | MCBQVDSZERMUPN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |