C18H26N2O5S — CID 160624286
tert-butyl 2-[4-[3-(2-oxoethyl)phenyl]sulfonylpiperazin-1-yl]acetate (PubChem CID 160624286) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is tert-butyl 2-[4-[3-(2-oxoethyl)phenyl]sulfonylpiperazin-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-[3-(2-oxoethyl)phenyl]sulfonylpiperazin-1-yl]acetate |
|---|---|
| PubChem CID | 160624286 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | tert-butyl 2-[4-[3-(2-oxoethyl)phenyl]sulfonylpiperazin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCN(S(=O)(=O)c2cccc(CC=O)c2)CC1 |
| InChI | InChI=1S/C18H26N2O5S/c1-18(2,3)25-17(22)14-19-8-10-20(11-9-19)26(23,24)16-6-4-5-15(13-16)7-12-21/h4-6,12-13H,7-11,14H2,1-3H3 |
| InChIKey | RHCAWENOKNKIRW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|