C16H22F2N2O4S — CID 8771407
tert-butyl 2-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]acetate (PubChem CID 8771407) has the molecular formula C16H22F2N2O4S and a molecular weight of 376.43 g/mol. Its IUPAC name is tert-butyl 2-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]acetate |
|---|---|
| PubChem CID | 8771407 |
| Molecular Formula | C16H22F2N2O4S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | tert-butyl 2-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCN(S(=O)(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C16H22F2N2O4S/c1-16(2,3)24-15(21)11-19-6-8-20(9-7-19)25(22,23)14-5-4-12(17)10-13(14)18/h4-5,10H,6-9,11H2,1-3H3 |
| InChIKey | AAMSZNNRUNQUMJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |