C16H21F3N2O2S — CID 8689327
1-(3-methylbut-2-enyl)-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine (PubChem CID 8689327) has the molecular formula C16H21F3N2O2S and a molecular weight of 362.42 g/mol. Its IUPAC name is 1-(3-methylbut-2-enyl)-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine.
| Compound Name | 1-(3-methylbut-2-enyl)-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 8689327 |
| Molecular Formula | C16H21F3N2O2S |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 1-(3-methylbut-2-enyl)-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine |
| SMILES | CC(C)=CCN1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H21F3N2O2S/c1-13(2)6-7-20-8-10-21(11-9-20)24(22,23)15-5-3-4-14(12-15)16(17,18)19/h3-6,12H,7-11H2,1-2H3 |
| InChIKey | BTSWKAUJYUHBSS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|