C15H16F3NO2S — CID 121187233
4-cyclopropylidene-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine (PubChem CID 121187233) has the molecular formula C15H16F3NO2S and a molecular weight of 331.36 g/mol. Its IUPAC name is 4-cyclopropylidene-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine.
| Compound Name | 4-cyclopropylidene-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 121187233 |
| Molecular Formula | C15H16F3NO2S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 4-cyclopropylidene-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)N1CCC(=C2CC2)CC1 |
| InChI | InChI=1S/C15H16F3NO2S/c16-15(17,18)13-2-1-3-14(10-13)22(20,21)19-8-6-12(7-9-19)11-4-5-11/h1-3,10H,4-9H2 |
| InChIKey | REIMYYZAMLWZQW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|