C12H12F3NO3S — CID 10709847
1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-one (PubChem CID 10709847) has the molecular formula C12H12F3NO3S and a molecular weight of 307.29 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-one.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-one |
|---|---|
| PubChem CID | 10709847 |
| Molecular Formula | C12H12F3NO3S |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-one |
| SMILES | O=C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C12H12F3NO3S/c13-12(14,15)9-2-1-3-11(8-9)20(18,19)16-6-4-10(17)5-7-16/h1-3,8H,4-7H2 |
| InChIKey | MIIHUGYGFKVDTQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |