C24H22F4N2O2S — CID 92772560
1-[(S)-(4-fluorophenyl)-phenylmethyl]-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine (PubChem CID 92772560) has the molecular formula C24H22F4N2O2S and a molecular weight of 478.51 g/mol. Its IUPAC name is 1-[(S)-(4-fluorophenyl)-phenylmethyl]-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine.
| Compound Name | 1-[(S)-(4-fluorophenyl)-phenylmethyl]-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 92772560 |
| Molecular Formula | C24H22F4N2O2S |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 1-[(S)-(4-fluorophenyl)-phenylmethyl]-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)N1CCN(C(c2ccccc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H22F4N2O2S/c25-21-11-9-19(10-12-21)23(18-5-2-1-3-6-18)29-13-15-30(16-14-29)33(31,32)22-8-4-7-20(17-22)24(26,27)28/h1-12,17,23H,13-16H2 |
| InChIKey | XQQWRBQQWMNNNU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |