C18H18FN3O2S — CID 110349642
2-[4-(benzenesulfonyl)piperazin-1-yl]-2-(4-fluorophenyl)acetonitrile (PubChem CID 110349642) has the molecular formula C18H18FN3O2S and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)piperazin-1-yl]-2-(4-fluorophenyl)acetonitrile.
| Compound Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]-2-(4-fluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 110349642 |
| Molecular Formula | C18H18FN3O2S |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]-2-(4-fluorophenyl)acetonitrile |
| SMILES | N#CC(c1ccc(F)cc1)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H18FN3O2S/c19-16-8-6-15(7-9-16)18(14-20)21-10-12-22(13-11-21)25(23,24)17-4-2-1-3-5-17/h1-9,18H,10-13H2 |
| InChIKey | ZFGPLMUKAQBYLH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |