C18H22FN2O2S+ — CID 8692484
1-(benzenesulfonyl)-4-[(1S)-1-(4-fluorophenyl)ethyl]piperazin-4-ium (PubChem CID 8692484) has the molecular formula C18H22FN2O2S+ and a molecular weight of 349.45 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-[(1S)-1-(4-fluorophenyl)ethyl]piperazin-4-ium.
| Compound Name | 1-(benzenesulfonyl)-4-[(1S)-1-(4-fluorophenyl)ethyl]piperazin-4-ium |
|---|---|
| PubChem CID | 8692484 |
| Molecular Formula | C18H22FN2O2S+ |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 1-(benzenesulfonyl)-4-[(1S)-1-(4-fluorophenyl)ethyl]piperazin-4-ium |
| SMILES | C[C@@H](c1ccc(F)cc1)[NH+]1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H21FN2O2S/c1-15(16-7-9-17(19)10-8-16)20-11-13-21(14-12-20)24(22,23)18-5-3-2-4-6-18/h2-10,15H,11-14H2,1H3/p+1/t15-/m0/s1 |
| InChIKey | GLWKBZBFDLHQLA-HNNXBMFYSA-O |
| XLogP | 1.48 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |