C18H21ClFN2O2S+ — CID 7967516
1-(3-chloro-4-fluorophenyl)sulfonyl-4-[(1R)-1-phenylethyl]piperazin-4-ium (PubChem CID 7967516) has the molecular formula C18H21ClFN2O2S+ and a molecular weight of 383.90 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)sulfonyl-4-[(1R)-1-phenylethyl]piperazin-4-ium.
| Compound Name | 1-(3-chloro-4-fluorophenyl)sulfonyl-4-[(1R)-1-phenylethyl]piperazin-4-ium |
|---|---|
| PubChem CID | 7967516 |
| Molecular Formula | C18H21ClFN2O2S+ |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)sulfonyl-4-[(1R)-1-phenylethyl]piperazin-4-ium |
| SMILES | C[C@H](c1ccccc1)[NH+]1CCN(S(=O)(=O)c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H20ClFN2O2S/c1-14(15-5-3-2-4-6-15)21-9-11-22(12-10-21)25(23,24)16-7-8-18(20)17(19)13-16/h2-8,13-14H,9-12H2,1H3/p+1/t14-/m1/s1 |
| InChIKey | QAWFRAWTBXAYEH-CQSZACIVSA-O |
| XLogP | 2.13 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |