C12H16ClFN2O4S2 — CID 31814418
1-(3-chloro-4-fluorophenyl)sulfonyl-4-methylsulfonyl-1,4-diazepane (PubChem CID 31814418) has the molecular formula C12H16ClFN2O4S2 and a molecular weight of 370.86 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)sulfonyl-4-methylsulfonyl-1,4-diazepane.
| Compound Name | 1-(3-chloro-4-fluorophenyl)sulfonyl-4-methylsulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 31814418 |
| Molecular Formula | C12H16ClFN2O4S2 |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)sulfonyl-4-methylsulfonyl-1,4-diazepane |
| SMILES | CS(=O)(=O)N1CCCN(S(=O)(=O)c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C12H16ClFN2O4S2/c1-21(17,18)15-5-2-6-16(8-7-15)22(19,20)10-3-4-12(14)11(13)9-10/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | VMOMTWNXGQNURU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |