C12H17ClN2O4S2 — CID 110799587
1-(4-chlorophenyl)sulfonyl-4-methylsulfonyl-1,4-diazepane (PubChem CID 110799587) has the molecular formula C12H17ClN2O4S2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-4-methylsulfonyl-1,4-diazepane.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-4-methylsulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 110799587 |
| Molecular Formula | C12H17ClN2O4S2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-4-methylsulfonyl-1,4-diazepane |
| SMILES | CS(=O)(=O)N1CCCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C12H17ClN2O4S2/c1-20(16,17)14-7-2-8-15(10-9-14)21(18,19)12-5-3-11(13)4-6-12/h3-6H,2,7-10H2,1H3 |
| InChIKey | YCQOINAESUZUKK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |