C16H15Cl3N2O4S2 — CID 35934098
1-(4-chlorophenyl)sulfonyl-4-(2,6-dichlorophenyl)sulfonylpiperazine (PubChem CID 35934098) has the molecular formula C16H15Cl3N2O4S2 and a molecular weight of 469.80 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-4-(2,6-dichlorophenyl)sulfonylpiperazine.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-4-(2,6-dichlorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 35934098 |
| Molecular Formula | C16H15Cl3N2O4S2 |
| Molecular Weight | 469.80 g/mol |
| Exact Mass | 467.95 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-4-(2,6-dichlorophenyl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C16H15Cl3N2O4S2/c17-12-4-6-13(7-5-12)26(22,23)20-8-10-21(11-9-20)27(24,25)16-14(18)2-1-3-15(16)19/h1-7H,8-11H2 |
| InChIKey | WMRJHMREZGJQSP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.80 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |