C17H23ClN2O2S — CID 11878975
1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-(4-chlorophenyl)sulfonylpiperazine (PubChem CID 11878975) has the molecular formula C17H23ClN2O2S and a molecular weight of 354.90 g/mol. Its IUPAC name is 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-(4-chlorophenyl)sulfonylpiperazine.
| Compound Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-(4-chlorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 11878975 |
| Molecular Formula | C17H23ClN2O2S |
| Molecular Weight | 354.90 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-(4-chlorophenyl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCN([C@@H]2C[C@H]3CC[C@@H]2C3)CC1 |
| InChI | InChI=1S/C17H23ClN2O2S/c18-15-3-5-16(6-4-15)23(21,22)20-9-7-19(8-10-20)17-12-13-1-2-14(17)11-13/h3-6,13-14,17H,1-2,7-12H2/t13-,14+,17+/m0/s1 |
| InChIKey | CYSHXVTZOQJHRF-JJRVBVJISA-N |
| XLogP | 2.83 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.90 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |