C17H23ClN2 — CID 6456424
1-(2-bicyclo[2.2.1]heptanyl)-4-(3-chlorophenyl)piperazine (PubChem CID 6456424) has the molecular formula C17H23ClN2 and a molecular weight of 290.84 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-4-(3-chlorophenyl)piperazine.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-4-(3-chlorophenyl)piperazine |
|---|---|
| PubChem CID | 6456424 |
| Molecular Formula | C17H23ClN2 |
| Molecular Weight | 290.84 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-4-(3-chlorophenyl)piperazine |
| SMILES | Clc1cccc(N2CCN(C3CC4CCC3C4)CC2)c1 |
| InChI | InChI=1S/C17H23ClN2/c18-15-2-1-3-16(12-15)19-6-8-20(9-7-19)17-11-13-4-5-14(17)10-13/h1-3,12-14,17H,4-11H2 |
| InChIKey | XVQLXPBCFBLINW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.84 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |