C16H23ClN2O — CID 102731807
trans-(1S,2S)-2-[4-(3-chlorophenyl)piperazin-1-yl]cyclohexan-1-ol (PubChem CID 102731807) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is trans-(1S,2S)-2-[4-(3-chlorophenyl)piperazin-1-yl]cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-[4-(3-chlorophenyl)piperazin-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102731807 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | trans-(1S,2S)-2-[4-(3-chlorophenyl)piperazin-1-yl]cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C16H23ClN2O/c17-13-4-3-5-14(12-13)18-8-10-19(11-9-18)15-6-1-2-7-16(15)20/h3-5,12,15-16,20H,1-2,6-11H2/t15-,16-/m0/s1 |
| InChIKey | FVFSCFADXUZOBJ-HOTGVXAUSA-N |
| XLogP | 2.77 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |