C20H30ClN3O3 — CID 142698791
tert-butyl 4-[4-(3-chlorophenyl)piperazin-1-yl]-3-hydroxypiperidine-1-carboxylate (PubChem CID 142698791) has the molecular formula C20H30ClN3O3 and a molecular weight of 395.93 g/mol. Its IUPAC name is tert-butyl 4-[4-(3-chlorophenyl)piperazin-1-yl]-3-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(3-chlorophenyl)piperazin-1-yl]-3-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 142698791 |
| Molecular Formula | C20H30ClN3O3 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | tert-butyl 4-[4-(3-chlorophenyl)piperazin-1-yl]-3-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CCN(c3cccc(Cl)c3)CC2)C(O)C1 |
| InChI | InChI=1S/C20H30ClN3O3/c1-20(2,3)27-19(26)24-8-7-17(18(25)14-24)23-11-9-22(10-12-23)16-6-4-5-15(21)13-16/h4-6,13,17-18,25H,7-12,14H2,1-3H3 |
| InChIKey | CXOBSSSLTPNZNM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |