C17H27ClN2O2 — CID 178158418
tert-butyl 4-(3-chlorophenyl)piperazine-1-carboxylate;ethane (PubChem CID 178158418) has the molecular formula C17H27ClN2O2 and a molecular weight of 326.87 g/mol. Its IUPAC name is tert-butyl 4-(3-chlorophenyl)piperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-(3-chlorophenyl)piperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 178158418 |
| Molecular Formula | C17H27ClN2O2 |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | tert-butyl 4-(3-chlorophenyl)piperazine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C15H21ClN2O2.C2H6/c1-15(2,3)20-14(19)18-9-7-17(8-10-18)13-6-4-5-12(16)11-13;1-2/h4-6,11H,7-10H2,1-3H3;1-2H3 |
| InChIKey | GLZIGDPEHMOLPB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |