C19H26ClN3O2 — CID 108958404
1-[4-(3-chlorophenyl)piperazin-1-yl]-2,2-dimethyl-3-pyrrolidin-1-ylpropane-1,3-dione (PubChem CID 108958404) has the molecular formula C19H26ClN3O2 and a molecular weight of 363.89 g/mol. Its IUPAC name is 1-[4-(3-chlorophenyl)piperazin-1-yl]-2,2-dimethyl-3-pyrrolidin-1-ylpropane-1,3-dione.
| Compound Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-2,2-dimethyl-3-pyrrolidin-1-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 108958404 |
| Molecular Formula | C19H26ClN3O2 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-2,2-dimethyl-3-pyrrolidin-1-ylpropane-1,3-dione |
| SMILES | CC(C)(C(=O)N1CCCC1)C(=O)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H26ClN3O2/c1-19(2,17(24)22-8-3-4-9-22)18(25)23-12-10-21(11-13-23)16-7-5-6-15(20)14-16/h5-7,14H,3-4,8-13H2,1-2H3 |
| InChIKey | ZZIJMKAOBJSKQC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|