C12H12Cl4N2O — CID 4196573
2,2,2-trichloro-1-[4-(3-chlorophenyl)piperazin-1-yl]ethanone (PubChem CID 4196573) has the molecular formula C12H12Cl4N2O and a molecular weight of 342.05 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[4-(3-chlorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2,2,2-trichloro-1-[4-(3-chlorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 4196573 |
| Molecular Formula | C12H12Cl4N2O |
| Molecular Weight | 342.05 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 2,2,2-trichloro-1-[4-(3-chlorophenyl)piperazin-1-yl]ethanone |
| SMILES | O=C(N1CCN(c2cccc(Cl)c2)CC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H12Cl4N2O/c13-9-2-1-3-10(8-9)17-4-6-18(7-5-17)11(19)12(14,15)16/h1-3,8H,4-7H2 |
| InChIKey | HGFZDALDXHISCW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.05 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|